About (CH3)2N-C(CH3)=NC2H5
(CH3)2N-C(CH3)=NC2H5 (PubChem CID 6432122) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is N'-ethyl-N,N-dimethylethanimidamide.
Molecular Properties
| Compound Name | (CH3)2N-C(CH3)=NC2H5 |
| PubChem CID | 6432122 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N'-ethyl-N,N-dimethylethanimidamide |
| SMILES | CCN=C(C)N(C)C |
| InChI | InChI=1S/C6H14N2/c1-5-7-6(2)8(3)4/h5H2,1-4H3 |
| InChIKey | ISBGMIISPIKHNE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | 84 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (CH3)2N-C(CH3)=NC2H5 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (CH3)2N-C(CH3)=NC2H5?
The IUPAC name of (CH3)2N-C(CH3)=NC2H5 (CID 6432122) is N'-ethyl-N,N-dimethylethanimidamide.
What is the SMILES notation for (CH3)2N-C(CH3)=NC2H5?
The canonical SMILES for (CH3)2N-C(CH3)=NC2H5 is CCN=C(C)N(C)C.
What is the InChIKey of (CH3)2N-C(CH3)=NC2H5?
The InChIKey is ISBGMIISPIKHNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-5-7-6(2)8(3)4/h5H2,1-4H3.
What are the key properties of (CH3)2N-C(CH3)=NC2H5?
(CH3)2N-C(CH3)=NC2H5 has a molecular weight of 114.19 g/mol, XLogP of 0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (CH3)2N-C(CH3)=NC2H5 is sourced from PubChem (CID 6432122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).