C26H46O8 — CID 6432750
tris(4-methylpentyl) 2-acetyloxypropane-1,2,3-tricarboxylate (PubChem CID 6432750) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is tris(4-methylpentyl) 2-acetyloxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(4-methylpentyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 6432750 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | tris(4-methylpentyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
| SMILES | CC(=O)OC(CC(=O)OCCCC(C)C)(CC(=O)OCCCC(C)C)C(=O)OCCCC(C)C |
| InChI | InChI=1S/C26H46O8/c1-19(2)11-8-14-31-23(28)17-26(34-22(7)27,25(30)33-16-10-13-21(5)6)18-24(29)32-15-9-12-20(3)4/h19-21H,8-18H2,1-7H3 |
| InChIKey | KTWCWRHURMHPCW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|