C35H64O8 — CID 87786193
tris(7-methyloctyl) 2-acetyloxypropane-1,2,3-tricarboxylate (PubChem CID 87786193) has the molecular formula C35H64O8 and a molecular weight of 612.89 g/mol. Its IUPAC name is tris(7-methyloctyl) 2-acetyloxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(7-methyloctyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 87786193 |
| Molecular Formula | C35H64O8 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.46 |
| IUPAC Name | tris(7-methyloctyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
| SMILES | CC(=O)OC(CC(=O)OCCCCCCC(C)C)(CC(=O)OCCCCCCC(C)C)C(=O)OCCCCCCC(C)C |
| InChI | InChI=1S/C35H64O8/c1-28(2)20-14-8-11-17-23-40-32(37)26-35(43-31(7)36,34(39)42-25-19-13-10-16-22-30(5)6)27-33(38)41-24-18-12-9-15-21-29(3)4/h28-30H,8-27H2,1-7H3 |
| InChIKey | SICQQDCYBOBLGT-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|