C38H70O8 — CID 86064151
tris(8-methylnonyl) 2-acetyloxypropane-1,2,3-tricarboxylate (PubChem CID 86064151) has the molecular formula C38H70O8 and a molecular weight of 654.97 g/mol. Its IUPAC name is tris(8-methylnonyl) 2-acetyloxypropane-1,2,3-tricarboxylate.
| Compound Name | tris(8-methylnonyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 86064151 |
| Molecular Formula | C38H70O8 |
| Molecular Weight | 654.97 g/mol |
| Exact Mass | 654.51 |
| IUPAC Name | tris(8-methylnonyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
| SMILES | CC(=O)OC(CC(=O)OCCCCCCCC(C)C)(CC(=O)OCCCCCCCC(C)C)C(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C38H70O8/c1-31(2)23-17-11-8-14-20-26-43-35(40)29-38(46-34(7)39,37(42)45-28-22-16-10-13-19-25-33(5)6)30-36(41)44-27-21-15-9-12-18-24-32(3)4/h31-33H,8-30H2,1-7H3 |
| InChIKey | KERRWYXSNZMPOY-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.97 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|