C18H25Cl2NO — CID 6434402
(E)-1-(3,4-dichlorophenyl)-4-(dimethylamino)-8-methylnon-1-en-3-one (PubChem CID 6434402) has the molecular formula C18H25Cl2NO and a molecular weight of 342.31 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorophenyl)-4-(dimethylamino)-8-methylnon-1-en-3-one.
| Compound Name | (E)-1-(3,4-dichlorophenyl)-4-(dimethylamino)-8-methylnon-1-en-3-one |
|---|---|
| PubChem CID | 6434402 |
| Molecular Formula | C18H25Cl2NO |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (E)-1-(3,4-dichlorophenyl)-4-(dimethylamino)-8-methylnon-1-en-3-one |
| SMILES | CC(C)CCCC(C(=O)/C=C/c1ccc(Cl)c(Cl)c1)N(C)C |
| InChI | InChI=1S/C18H25Cl2NO/c1-13(2)6-5-7-17(21(3)4)18(22)11-9-14-8-10-15(19)16(20)12-14/h8-13,17H,5-7H2,1-4H3/b11-9+ |
| InChIKey | IYFWVSDXJACRLT-PKNBQFBNSA-N |
| XLogP | 5.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|