C31H54O2 — CID 6437125
11,11-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]undec-1-ene (PubChem CID 6437125) has the molecular formula C31H54O2 and a molecular weight of 458.77 g/mol. Its IUPAC name is 11,11-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]undec-1-ene.
| Compound Name | 11,11-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]undec-1-ene |
|---|---|
| PubChem CID | 6437125 |
| Molecular Formula | C31H54O2 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.41 |
| IUPAC Name | 11,11-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]undec-1-ene |
| SMILES | C=CCCCCCCCCC(OC/C=C(\C)CCC=C(C)C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C31H54O2/c1-8-9-10-11-12-13-14-15-22-31(32-25-23-29(6)20-16-18-27(2)3)33-26-24-30(7)21-17-19-28(4)5/h8,18-19,23-24,31H,1,9-17,20-22,25-26H2,2-7H3/b29-23+,30-24+ |
| InChIKey | QBQQCPSBCXSFTA-HCTXVGCHSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|