C17H17ClN2 — CID 6437617
(E)-N,N'-diphenylpent-2-ene-1,5-diimine;hydrochloride (PubChem CID 6437617) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is (E)-N,N'-diphenylpent-2-ene-1,5-diimine;hydrochloride.
| Compound Name | (E)-N,N'-diphenylpent-2-ene-1,5-diimine;hydrochloride |
|---|---|
| PubChem CID | 6437617 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (E)-N,N'-diphenylpent-2-ene-1,5-diimine;hydrochloride |
| SMILES | C(=C/C/C=N/c1ccccc1)\C=N\c1ccccc1.Cl |
| InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-8,10-15H,9H2;1H/b8-3+,18-14+,19-15+; |
| InChIKey | JWYFJOIJMPZWDB-CADPLVDMSA-N |
| XLogP | 5.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|