C38H75NO2 — CID 6437986
(Z)-N,N-dimethyloctadec-9-en-1-amine;(Z)-octadec-9-enoic acid (PubChem CID 6437986) has the molecular formula C38H75NO2 and a molecular weight of 578.02 g/mol. Its IUPAC name is (Z)-N,N-dimethyloctadec-9-en-1-amine;(Z)-octadec-9-enoic acid.
| Compound Name | (Z)-N,N-dimethyloctadec-9-en-1-amine;(Z)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6437986 |
| Molecular Formula | C38H75NO2 |
| Molecular Weight | 578.02 g/mol |
| Exact Mass | 577.58 |
| IUPAC Name | (Z)-N,N-dimethyloctadec-9-en-1-amine;(Z)-octadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCCCCCCC/C=C\CCCCCCCCN(C)C |
| InChI | InChI=1S/C20H41N.C18H34O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h11-12H,4-10,13-20H2,1-3H3;9-10H,2-8,11-17H2,1H3,(H,19,20)/b12-11-;10-9- |
| InChIKey | RQPVLZDUSMVKJH-RNCLGPNQSA-N |
| XLogP | 12.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.02 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|