C23H28ClNO5 — CID 6444875
2-(diethylamino)ethyl (E)-2-(4-chlorophenoxy)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 6444875) has the molecular formula C23H28ClNO5 and a molecular weight of 433.93 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (E)-2-(4-chlorophenoxy)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-(diethylamino)ethyl (E)-2-(4-chlorophenoxy)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6444875 |
| Molecular Formula | C23H28ClNO5 |
| Molecular Weight | 433.93 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-(diethylamino)ethyl (E)-2-(4-chlorophenoxy)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCN(CC)CCOC(=O)/C(=C\c1ccc(OC)c(OC)c1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H28ClNO5/c1-5-25(6-2)13-14-29-23(26)22(30-19-10-8-18(24)9-11-19)16-17-7-12-20(27-3)21(15-17)28-4/h7-12,15-16H,5-6,13-14H2,1-4H3/b22-16+ |
| InChIKey | RGFDVZTWXPKYKS-CJLVFECKSA-N |
| XLogP | 4.66 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.93 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|