C20H17NO — CID 6446244
(Z)-1,3-diphenyl-1-pyridin-3-ylprop-2-en-1-ol (PubChem CID 6446244) has the molecular formula C20H17NO and a molecular weight of 287.36 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-1-pyridin-3-ylprop-2-en-1-ol.
| Compound Name | (Z)-1,3-diphenyl-1-pyridin-3-ylprop-2-en-1-ol |
|---|---|
| PubChem CID | 6446244 |
| Molecular Formula | C20H17NO |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (Z)-1,3-diphenyl-1-pyridin-3-ylprop-2-en-1-ol |
| SMILES | OC(/C=C\c1ccccc1)(c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C20H17NO/c22-20(18-10-5-2-6-11-18,19-12-7-15-21-16-19)14-13-17-8-3-1-4-9-17/h1-16,22H/b14-13- |
| InChIKey | ZQWGIVXOPJYMTK-YPKPFQOOSA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |