C16H20O8S2 — CID 6446536
(E)-4-[[2-[1,3-dioxo-1,3-di(propan-2-yloxy)propan-2-ylidene]-1,3-dithiolan-4-yl]oxy]-4-oxobut-2-enoic acid (PubChem CID 6446536) has the molecular formula C16H20O8S2 and a molecular weight of 404.46 g/mol. Its IUPAC name is (E)-4-[[2-[1,3-dioxo-1,3-di(propan-2-yloxy)propan-2-ylidene]-1,3-dithiolan-4-yl]oxy]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[2-[1,3-dioxo-1,3-di(propan-2-yloxy)propan-2-ylidene]-1,3-dithiolan-4-yl]oxy]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 6446536 |
| Molecular Formula | C16H20O8S2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (E)-4-[[2-[1,3-dioxo-1,3-di(propan-2-yloxy)propan-2-ylidene]-1,3-dithiolan-4-yl]oxy]-4-oxobut-2-enoic acid |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)=C1SCC(OC(=O)/C=C/C(=O)O)S1 |
| InChI | InChI=1S/C16H20O8S2/c1-8(2)22-14(20)13(15(21)23-9(3)4)16-25-7-12(26-16)24-11(19)6-5-10(17)18/h5-6,8-9,12H,7H2,1-4H3,(H,17,18)/b6-5+ |
| InChIKey | HVPFLALUSUNCPJ-AATRIKPKSA-N |
| XLogP | 2.09 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|