C8H11NO3S2 — CID 10399099
propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate (PubChem CID 10399099) has the molecular formula C8H11NO3S2 and a molecular weight of 233.31 g/mol. Its IUPAC name is propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate.
| Compound Name | propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
|---|---|
| PubChem CID | 10399099 |
| Molecular Formula | C8H11NO3S2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
| SMILES | CC(C)OC(=O)C(C(N)=O)=C1SCS1 |
| InChI | InChI=1S/C8H11NO3S2/c1-4(2)12-7(11)5(6(9)10)8-13-3-14-8/h4H,3H2,1-2H3,(H2,9,10) |
| InChIKey | WTMZTSCWGPOCBP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|