About propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate
propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate (PubChem CID 10399099) has the molecular formula C8H11NO3S2
and a molecular weight of 233.31 g/mol. Its IUPAC name is propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate.
Molecular Properties
| Compound Name | propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
| PubChem CID | 10399099 |
| Molecular Formula | C8H11NO3S2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.02 |
| IUPAC Name | propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate |
| SMILES | CC(C)OC(=O)C(C(N)=O)=C1SCS1 |
| InChI | InChI=1S/C8H11NO3S2/c1-4(2)12-7(11)5(6(9)10)8-13-3-14-8/h4H,3H2,1-2H3,(H2,9,10) |
| InChIKey | WTMZTSCWGPOCBP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate?
The IUPAC name of propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate (CID 10399099) is propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate.
What is the SMILES notation for propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate?
The canonical SMILES for propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate is CC(C)OC(=O)C(C(N)=O)=C1SCS1.
What is the InChIKey of propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate?
The InChIKey is WTMZTSCWGPOCBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S2/c1-4(2)12-7(11)5(6(9)10)8-13-3-14-8/h4H,3H2,1-2H3,(H2,9,10).
What are the key properties of propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate?
propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate has a molecular weight of 233.31 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-amino-2-(1,3-dithietan-2-ylidene)-3-oxopropanoate is sourced from PubChem (CID 10399099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).