C11H16Cl3NO4 — CID 15556869
dipropan-2-yl 2-(1-amino-2,2,2-trichloroethylidene)propanedioate (PubChem CID 15556869) has the molecular formula C11H16Cl3NO4 and a molecular weight of 332.61 g/mol. Its IUPAC name is dipropan-2-yl 2-(1-amino-2,2,2-trichloroethylidene)propanedioate.
| Compound Name | dipropan-2-yl 2-(1-amino-2,2,2-trichloroethylidene)propanedioate |
|---|---|
| PubChem CID | 15556869 |
| Molecular Formula | C11H16Cl3NO4 |
| Molecular Weight | 332.61 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | dipropan-2-yl 2-(1-amino-2,2,2-trichloroethylidene)propanedioate |
| SMILES | CC(C)OC(=O)C(C(=O)OC(C)C)=C(N)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16Cl3NO4/c1-5(2)18-9(16)7(8(15)11(12,13)14)10(17)19-6(3)4/h5-6H,15H2,1-4H3 |
| InChIKey | DWGBKOQCSJWENM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.61 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|