C12H9N3O3S — CID 6449138
(6E)-6-[(4-nitrophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-one (PubChem CID 6449138) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is (6E)-6-[(4-nitrophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-one.
| Compound Name | (6E)-6-[(4-nitrophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-one |
|---|---|
| PubChem CID | 6449138 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | (6E)-6-[(4-nitrophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-one |
| SMILES | O=C1/C(=C\c2ccc([N+](=O)[O-])cc2)N=C2SCCN12 |
| InChI | InChI=1S/C12H9N3O3S/c16-11-10(13-12-14(11)5-6-19-12)7-8-1-3-9(4-2-8)15(17)18/h1-4,7H,5-6H2/b10-7+ |
| InChIKey | VRZIDGJMVGHLNU-JXMROGBWSA-N |
| XLogP | 1.88 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|