C14H22OS — CID 64502667
6-(5-ethylthiophen-2-yl)-2,2-dimethylhexan-3-one (PubChem CID 64502667) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 6-(5-ethylthiophen-2-yl)-2,2-dimethylhexan-3-one.
| Compound Name | 6-(5-ethylthiophen-2-yl)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 64502667 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 6-(5-ethylthiophen-2-yl)-2,2-dimethylhexan-3-one |
| SMILES | CCc1ccc(CCCC(=O)C(C)(C)C)s1 |
| InChI | InChI=1S/C14H22OS/c1-5-11-9-10-12(16-11)7-6-8-13(15)14(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | DWGUSYGDDRATEX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |