C18H29Br — CID 64509236
1-(4-bromo-5,5-dimethylhexyl)-4-tert-butylbenzene (PubChem CID 64509236) has the molecular formula C18H29Br and a molecular weight of 325.33 g/mol. Its IUPAC name is 1-(4-bromo-5,5-dimethylhexyl)-4-tert-butylbenzene.
| Compound Name | 1-(4-bromo-5,5-dimethylhexyl)-4-tert-butylbenzene |
|---|---|
| PubChem CID | 64509236 |
| Molecular Formula | C18H29Br |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-(4-bromo-5,5-dimethylhexyl)-4-tert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(CCCC(Br)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H29Br/c1-17(2,3)15-12-10-14(11-13-15)8-7-9-16(19)18(4,5)6/h10-13,16H,7-9H2,1-6H3 |
| InChIKey | UBVIJJNZNLJGRY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|