C33H55N3 — CID 90674858
N'-[3-[1,7-bis(4-tert-butylphenyl)heptan-4-ylamino]propyl]propane-1,3-diamine (PubChem CID 90674858) has the molecular formula C33H55N3 and a molecular weight of 493.82 g/mol. Its IUPAC name is N'-[3-[1,7-bis(4-tert-butylphenyl)heptan-4-ylamino]propyl]propane-1,3-diamine.
| Compound Name | N'-[3-[1,7-bis(4-tert-butylphenyl)heptan-4-ylamino]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 90674858 |
| Molecular Formula | C33H55N3 |
| Molecular Weight | 493.82 g/mol |
| Exact Mass | 493.44 |
| IUPAC Name | N'-[3-[1,7-bis(4-tert-butylphenyl)heptan-4-ylamino]propyl]propane-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(CCCC(CCCc2ccc(C(C)(C)C)cc2)NCCCNCCCN)cc1 |
| InChI | InChI=1S/C33H55N3/c1-32(2,3)29-19-15-27(16-20-29)11-7-13-31(36-26-10-25-35-24-9-23-34)14-8-12-28-17-21-30(22-18-28)33(4,5)6/h15-22,31,35-36H,7-14,23-26,34H2,1-6H3 |
| InChIKey | KDROWGUQUPVDLY-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.82 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|