C14H17Cl3 — CID 64509532
1-chloro-3-[(2,6-dichlorophenyl)methyl]cycloheptane (PubChem CID 64509532) has the molecular formula C14H17Cl3 and a molecular weight of 291.65 g/mol. Its IUPAC name is 1-chloro-3-[(2,6-dichlorophenyl)methyl]cycloheptane.
| Compound Name | 1-chloro-3-[(2,6-dichlorophenyl)methyl]cycloheptane |
|---|---|
| PubChem CID | 64509532 |
| Molecular Formula | C14H17Cl3 |
| Molecular Weight | 291.65 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 1-chloro-3-[(2,6-dichlorophenyl)methyl]cycloheptane |
| SMILES | Clc1cccc(Cl)c1CC1CCCCC(Cl)C1 |
| InChI | InChI=1S/C14H17Cl3/c15-11-5-2-1-4-10(8-11)9-12-13(16)6-3-7-14(12)17/h3,6-7,10-11H,1-2,4-5,8-9H2 |
| InChIKey | BUOCGYMLALOYSD-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.65 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|