C10H11Cl2N — CID 16780191
3-[(2,6-dichlorophenyl)methyl]azetidine (PubChem CID 16780191) has the molecular formula C10H11Cl2N and a molecular weight of 216.11 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]azetidine.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]azetidine |
|---|---|
| PubChem CID | 16780191 |
| Molecular Formula | C10H11Cl2N |
| Molecular Weight | 216.11 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]azetidine |
| SMILES | Clc1cccc(Cl)c1CC1CNC1 |
| InChI | InChI=1S/C10H11Cl2N/c11-9-2-1-3-10(12)8(9)4-7-5-13-6-7/h1-3,7,13H,4-6H2 |
| InChIKey | PBXBJFQQDWTBIH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.11 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |