C15H19N5O — CID 64523270
(3-amino-1H-pyrazol-5-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 64523270) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is (3-amino-1H-pyrazol-5-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (3-amino-1H-pyrazol-5-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 64523270 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (3-amino-1H-pyrazol-5-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccccc1N1CCN(C(=O)c2cc(N)n[nH]2)CC1 |
| InChI | InChI=1S/C15H19N5O/c1-11-4-2-3-5-13(11)19-6-8-20(9-7-19)15(21)12-10-14(16)18-17-12/h2-5,10H,6-9H2,1H3,(H3,16,17,18) |
| InChIKey | XKEPZDFPWQTQDF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |