C12H13BrN4O — CID 64523433
3-amino-N-(4-bromo-2,6-dimethylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 64523433) has the molecular formula C12H13BrN4O and a molecular weight of 309.17 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,6-dimethylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(4-bromo-2,6-dimethylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64523433 |
| Molecular Formula | C12H13BrN4O |
| Molecular Weight | 309.17 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 3-amino-N-(4-bromo-2,6-dimethylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C12H13BrN4O/c1-6-3-8(13)4-7(2)11(6)15-12(18)9-5-10(14)17-16-9/h3-5H,1-2H3,(H,15,18)(H3,14,16,17) |
| InChIKey | OQMLLCJXUUMXDD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |