About dichloro(dimethyl)silane;tetrachlorosilane
dichloro(dimethyl)silane;tetrachlorosilane (PubChem CID 6452398) has the molecular formula C2H6Cl6Si2
and a molecular weight of 298.96 g/mol. Its IUPAC name is dichloro(dimethyl)silane;tetrachlorosilane.
Molecular Properties
| Compound Name | dichloro(dimethyl)silane;tetrachlorosilane |
| PubChem CID | 6452398 |
| Molecular Formula | C2H6Cl6Si2 |
| Molecular Weight | 298.96 g/mol |
| Exact Mass | 295.81 |
| IUPAC Name | dichloro(dimethyl)silane;tetrachlorosilane |
| SMILES | C[Si](C)(Cl)Cl.Cl[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C2H6Cl2Si.Cl4Si/c2*1-5(2,3)4/h1-2H3; |
| InChIKey | RQCXLHVIHGNBIH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethyl)silane;tetrachlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethyl)silane;tetrachlorosilane?
The IUPAC name of dichloro(dimethyl)silane;tetrachlorosilane (CID 6452398) is dichloro(dimethyl)silane;tetrachlorosilane.
What is the SMILES notation for dichloro(dimethyl)silane;tetrachlorosilane?
The canonical SMILES for dichloro(dimethyl)silane;tetrachlorosilane is C[Si](C)(Cl)Cl.Cl[Si](Cl)(Cl)Cl.
What is the InChIKey of dichloro(dimethyl)silane;tetrachlorosilane?
The InChIKey is RQCXLHVIHGNBIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6Cl2Si.Cl4Si/c2*1-5(2,3)4/h1-2H3;.
What are the key properties of dichloro(dimethyl)silane;tetrachlorosilane?
dichloro(dimethyl)silane;tetrachlorosilane has a molecular weight of 298.96 g/mol, XLogP of 4.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethyl)silane;tetrachlorosilane is sourced from PubChem (CID 6452398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).