3-piperidin-1-ylnonanoic acid

C14H27NO2 — CID 64527594

IUPAC3-piperidin-1-ylnonanoic acid
SMILESCCCCCCC(CC(=O)O)N1CCCCC1
InChIInChI=1S/C14H27NO2/c1-2-3-4-6-9-13(12-14(16)17)15-10-7-5-8-11-15/h13H,2-12H2,1H3,(H,16,17)
InChIKeyTYFKDAXJUTWMTG-UHFFFAOYSA-N
MW241.37 g/mol
LogP3.29
Rot. Bonds8

About 3-piperidin-1-ylnonanoic acid

3-piperidin-1-ylnonanoic acid (PubChem CID 64527594) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 3-piperidin-1-ylnonanoic acid.

Molecular Properties

Compound Name3-piperidin-1-ylnonanoic acid
PubChem CID64527594
Molecular FormulaC14H27NO2
Molecular Weight241.37 g/mol
Exact Mass241.20
IUPAC Name3-piperidin-1-ylnonanoic acid
SMILESCCCCCCC(CC(=O)O)N1CCCCC1
InChIInChI=1S/C14H27NO2/c1-2-3-4-6-9-13(12-14(16)17)15-10-7-5-8-11-15/h13H,2-12H2,1H3,(H,16,17)
InChIKeyTYFKDAXJUTWMTG-UHFFFAOYSA-N
XLogP3.29
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.37
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-piperidin-1-ylnonanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-piperidin-1-ylnonanoic acid?
The IUPAC name of 3-piperidin-1-ylnonanoic acid (CID 64527594) is 3-piperidin-1-ylnonanoic acid.
What is the SMILES notation for 3-piperidin-1-ylnonanoic acid?
The canonical SMILES for 3-piperidin-1-ylnonanoic acid is CCCCCCC(CC(=O)O)N1CCCCC1.
What is the InChIKey of 3-piperidin-1-ylnonanoic acid?
The InChIKey is TYFKDAXJUTWMTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO2/c1-2-3-4-6-9-13(12-14(16)17)15-10-7-5-8-11-15/h13H,2-12H2,1H3,(H,16,17).
What are the key properties of 3-piperidin-1-ylnonanoic acid?
3-piperidin-1-ylnonanoic acid has a molecular weight of 241.37 g/mol, XLogP of 3.29, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylnonanoic acid is sourced from PubChem (CID 64527594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).