C15H21Cl2NO2 — CID 64542042
ethyl 3-(2,3-dichlorophenyl)-3-(diethylamino)propanoate (PubChem CID 64542042) has the molecular formula C15H21Cl2NO2 and a molecular weight of 318.24 g/mol. Its IUPAC name is ethyl 3-(2,3-dichlorophenyl)-3-(diethylamino)propanoate.
| Compound Name | ethyl 3-(2,3-dichlorophenyl)-3-(diethylamino)propanoate |
|---|---|
| PubChem CID | 64542042 |
| Molecular Formula | C15H21Cl2NO2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | ethyl 3-(2,3-dichlorophenyl)-3-(diethylamino)propanoate |
| SMILES | CCOC(=O)CC(c1cccc(Cl)c1Cl)N(CC)CC |
| InChI | InChI=1S/C15H21Cl2NO2/c1-4-18(5-2)13(10-14(19)20-6-3)11-8-7-9-12(16)15(11)17/h7-9,13H,4-6,10H2,1-3H3 |
| InChIKey | OVMZTLNLGXLFSP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |