C16H23N3S — CID 64551733
4-ethyl-4-methyl-N-(4-pyrrolidin-1-ylphenyl)-5H-1,3-thiazol-2-amine (PubChem CID 64551733) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 4-ethyl-4-methyl-N-(4-pyrrolidin-1-ylphenyl)-5H-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-4-methyl-N-(4-pyrrolidin-1-ylphenyl)-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 64551733 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 4-ethyl-4-methyl-N-(4-pyrrolidin-1-ylphenyl)-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(C)CSC(Nc2ccc(N3CCCC3)cc2)=N1 |
| InChI | InChI=1S/C16H23N3S/c1-3-16(2)12-20-15(18-16)17-13-6-8-14(9-7-13)19-10-4-5-11-19/h6-9H,3-5,10-12H2,1-2H3,(H,17,18) |
| InChIKey | CBDSIDZMCZJUOW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|