C11H12F5NO — CID 64556841
2-methyl-2-(2,3,4,5,6-pentafluoroanilino)butan-1-ol (PubChem CID 64556841) has the molecular formula C11H12F5NO and a molecular weight of 269.21 g/mol. Its IUPAC name is 2-methyl-2-(2,3,4,5,6-pentafluoroanilino)butan-1-ol.
| Compound Name | 2-methyl-2-(2,3,4,5,6-pentafluoroanilino)butan-1-ol |
|---|---|
| PubChem CID | 64556841 |
| Molecular Formula | C11H12F5NO |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-methyl-2-(2,3,4,5,6-pentafluoroanilino)butan-1-ol |
| SMILES | CCC(C)(CO)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H12F5NO/c1-3-11(2,4-18)17-10-8(15)6(13)5(12)7(14)9(10)16/h17-18H,3-4H2,1-2H3 |
| InChIKey | JFBZPQGIOSTKAL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|