C12H12N6O — CID 64559397
3-(3-cyano-1,2,4-triazol-1-yl)-2-phenylpropanehydrazide (PubChem CID 64559397) has the molecular formula C12H12N6O and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-(3-cyano-1,2,4-triazol-1-yl)-2-phenylpropanehydrazide.
| Compound Name | 3-(3-cyano-1,2,4-triazol-1-yl)-2-phenylpropanehydrazide |
|---|---|
| PubChem CID | 64559397 |
| Molecular Formula | C12H12N6O |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(3-cyano-1,2,4-triazol-1-yl)-2-phenylpropanehydrazide |
| SMILES | N#Cc1ncn(CC(C(=O)NN)c2ccccc2)n1 |
| InChI | InChI=1S/C12H12N6O/c13-6-11-15-8-18(17-11)7-10(12(19)16-14)9-4-2-1-3-5-9/h1-5,8,10H,7,14H2,(H,16,19) |
| InChIKey | CJXOWVOUKJRPSV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|