C8H17N5S — CID 64571973
3-amino-4-[4-(dimethylamino)butyl]-1H-1,2,4-triazole-5-thione (PubChem CID 64571973) has the molecular formula C8H17N5S and a molecular weight of 215.33 g/mol. Its IUPAC name is 3-amino-4-[4-(dimethylamino)butyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[4-(dimethylamino)butyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 64571973 |
| Molecular Formula | C8H17N5S |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-amino-4-[4-(dimethylamino)butyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CN(C)CCCCn1c(N)n[nH]c1=S |
| InChI | InChI=1S/C8H17N5S/c1-12(2)5-3-4-6-13-7(9)10-11-8(13)14/h3-6H2,1-2H3,(H2,9,10)(H,11,14) |
| InChIKey | SNKZZELDMPIPTM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|