C13H16N6O — CID 64575387
4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-methylbenzamide (PubChem CID 64575387) has the molecular formula C13H16N6O and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-methylbenzamide.
| Compound Name | 4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 64575387 |
| Molecular Formula | C13H16N6O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 4-amino-3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N)c(N2CCn3cnnc3C2)c1 |
| InChI | InChI=1S/C13H16N6O/c1-15-13(20)9-2-3-10(14)11(6-9)18-4-5-19-8-16-17-12(19)7-18/h2-3,6,8H,4-5,7,14H2,1H3,(H,15,20) |
| InChIKey | FJNRSZWUKRGXFU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|