2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid

C9H11N3O5 — CID 64583489

IUPAC2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid
SMILESCC(=O)NC(Cn1[nH]c(=O)ccc1=O)C(=O)O
InChIInChI=1S/C9H11N3O5/c1-5(13)10-6(9(16)17)4-12-8(15)3-2-7(14)11-12/h2-3,6H,4H2,1H3,(H,10,13)(H,11,14)(H,16,17)
InChIKeyOZQAASVSRCURLD-UHFFFAOYSA-N
MW241.20 g/mol
LogP-1.87
Rot. Bonds4

About 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid

2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid (PubChem CID 64583489) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid.

Molecular Properties

Compound Name2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid
PubChem CID64583489
Molecular FormulaC9H11N3O5
Molecular Weight241.20 g/mol
Exact Mass241.07
IUPAC Name2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid
SMILESCC(=O)NC(Cn1[nH]c(=O)ccc1=O)C(=O)O
InChIInChI=1S/C9H11N3O5/c1-5(13)10-6(9(16)17)4-12-8(15)3-2-7(14)11-12/h2-3,6H,4H2,1H3,(H,10,13)(H,11,14)(H,16,17)
InChIKeyOZQAASVSRCURLD-UHFFFAOYSA-N
XLogP-1.87
TPSA121.26 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.20
LogP ≤ 5-1.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid?
The IUPAC name of 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid (CID 64583489) is 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid.
What is the SMILES notation for 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid?
The canonical SMILES for 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid is CC(=O)NC(Cn1[nH]c(=O)ccc1=O)C(=O)O.
What is the InChIKey of 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid?
The InChIKey is OZQAASVSRCURLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O5/c1-5(13)10-6(9(16)17)4-12-8(15)3-2-7(14)11-12/h2-3,6H,4H2,1H3,(H,10,13)(H,11,14)(H,16,17).
What are the key properties of 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid?
2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid has a molecular weight of 241.20 g/mol, XLogP of -1.87, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-(3,6-dioxo-1H-pyridazin-2-yl)propanoic acid is sourced from PubChem (CID 64583489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).