C8H8F3N7 — CID 64584120
N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 64584120) has the molecular formula C8H8F3N7 and a molecular weight of 259.20 g/mol. Its IUPAC name is N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 64584120 |
| Molecular Formula | C8H8F3N7 |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-[1-(2H-tetrazol-5-yl)ethyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CC(Nc1nccc(C(F)(F)F)n1)c1nn[nH]n1 |
| InChI | InChI=1S/C8H8F3N7/c1-4(6-15-17-18-16-6)13-7-12-3-2-5(14-7)8(9,10)11/h2-4H,1H3,(H,12,13,14)(H,15,16,17,18) |
| InChIKey | AHFLRPZDQJFURC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |