C18H24N2O — CID 64584824
2-(N-butylanilino)-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone (PubChem CID 64584824) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-(N-butylanilino)-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone.
| Compound Name | 2-(N-butylanilino)-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 64584824 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-(N-butylanilino)-1-(2,5-dimethyl-1H-pyrrol-3-yl)ethanone |
| SMILES | CCCCN(CC(=O)c1cc(C)[nH]c1C)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O/c1-4-5-11-20(16-9-7-6-8-10-16)13-18(21)17-12-14(2)19-15(17)3/h6-10,12,19H,4-5,11,13H2,1-3H3 |
| InChIKey | ZOQILEBAXSQHEJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |