C10H13N3O2 — CID 64592763
[5-[(1H-pyrazol-4-ylmethylamino)methyl]furan-2-yl]methanol (PubChem CID 64592763) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is [5-[(1H-pyrazol-4-ylmethylamino)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(1H-pyrazol-4-ylmethylamino)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 64592763 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | [5-[(1H-pyrazol-4-ylmethylamino)methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CNCc2cn[nH]c2)o1 |
| InChI | InChI=1S/C10H13N3O2/c14-7-10-2-1-9(15-10)6-11-3-8-4-12-13-5-8/h1-2,4-5,11,14H,3,6-7H2,(H,12,13) |
| InChIKey | WPRWSKLBRDGVCS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |