C11H12N4S2 — CID 64593735
6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-2-carbothioamide (PubChem CID 64593735) has the molecular formula C11H12N4S2 and a molecular weight of 264.38 g/mol. Its IUPAC name is 6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-2-carbothioamide.
| Compound Name | 6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 64593735 |
| Molecular Formula | C11H12N4S2 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 6-[1-(1,3-thiazol-2-yl)ethylamino]pyridine-2-carbothioamide |
| SMILES | CC(Nc1cccc(C(N)=S)n1)c1nccs1 |
| InChI | InChI=1S/C11H12N4S2/c1-7(11-13-5-6-17-11)14-9-4-2-3-8(15-9)10(12)16/h2-7H,1H3,(H2,12,16)(H,14,15) |
| InChIKey | RVPZPHFXJGHJCT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|