C16H18N4 — CID 64596515
6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridine-2-carboximidamide (PubChem CID 64596515) has the molecular formula C16H18N4 and a molecular weight of 266.35 g/mol. Its IUPAC name is 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridine-2-carboximidamide.
| Compound Name | 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 64596515 |
| Molecular Formula | C16H18N4 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 6-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2c3ccccc3CCC2C)n1 |
| InChI | InChI=1S/C16H18N4/c1-11-9-10-12-5-2-3-7-14(12)20(11)15-8-4-6-13(19-15)16(17)18/h2-8,11H,9-10H2,1H3,(H3,17,18) |
| InChIKey | XKBBEMKXMZRWOE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|