C11H17BrN2 — CID 64597766
5-bromo-N-(2,3-dimethylbutyl)pyridin-2-amine (PubChem CID 64597766) has the molecular formula C11H17BrN2 and a molecular weight of 257.18 g/mol. Its IUPAC name is 5-bromo-N-(2,3-dimethylbutyl)pyridin-2-amine.
| Compound Name | 5-bromo-N-(2,3-dimethylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 64597766 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-bromo-N-(2,3-dimethylbutyl)pyridin-2-amine |
| SMILES | CC(C)C(C)CNc1ccc(Br)cn1 |
| InChI | InChI=1S/C11H17BrN2/c1-8(2)9(3)6-13-11-5-4-10(12)7-14-11/h4-5,7-9H,6H2,1-3H3,(H,13,14) |
| InChIKey | ZVUBAUSPFQYKFW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |