C13H15ClN2O2 — CID 64601411
N-[[5-[(5-chloro-3-pyridinyl)oxymethyl]furan-3-yl]methyl]ethanamine (PubChem CID 64601411) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is N-[[5-[(5-chloro-3-pyridinyl)oxymethyl]furan-3-yl]methyl]ethanamine.
| Compound Name | N-[[5-[(5-chloro-3-pyridinyl)oxymethyl]furan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 64601411 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | N-[[5-[(5-chloro-3-pyridinyl)oxymethyl]furan-3-yl]methyl]ethanamine |
| SMILES | CCNCc1coc(COc2cncc(Cl)c2)c1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-2-15-5-10-3-13(17-8-10)9-18-12-4-11(14)6-16-7-12/h3-4,6-8,15H,2,5,9H2,1H3 |
| InChIKey | DGGACADFZGWAKF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |