C11H17ClN2O2 — CID 66335510
1-[(5-chloro-3-pyridinyl)oxy]-3-(ethylamino)-2-methylpropan-2-ol (PubChem CID 66335510) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 1-[(5-chloro-3-pyridinyl)oxy]-3-(ethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-[(5-chloro-3-pyridinyl)oxy]-3-(ethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 66335510 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-[(5-chloro-3-pyridinyl)oxy]-3-(ethylamino)-2-methylpropan-2-ol |
| SMILES | CCNCC(C)(O)COc1cncc(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2O2/c1-3-13-7-11(2,15)8-16-10-4-9(12)5-14-6-10/h4-6,13,15H,3,7-8H2,1-2H3 |
| InChIKey | AHPPJLIZFFQFSO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |