C12H15N3O3S2 — CID 6461834
N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide (PubChem CID 6461834) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide.
| Compound Name | N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 6461834 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[5-(3-phenoxypropyl)-1,3,4-thiadiazol-2-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nnc(CCCOc2ccccc2)s1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-20(16,17)15-12-14-13-11(19-12)8-5-9-18-10-6-3-2-4-7-10/h2-4,6-7H,5,8-9H2,1H3,(H,14,15) |
| InChIKey | KYJPNCJWHXGSOS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|