C19H23N3O3S2 — CID 6462367
N-cyclohexyl-2-[4-(pyridin-3-ylsulfamoyl)phenyl]sulfanylacetamide (PubChem CID 6462367) has the molecular formula C19H23N3O3S2 and a molecular weight of 405.55 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-(pyridin-3-ylsulfamoyl)phenyl]sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-[4-(pyridin-3-ylsulfamoyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 6462367 |
| Molecular Formula | C19H23N3O3S2 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-cyclohexyl-2-[4-(pyridin-3-ylsulfamoyl)phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccc(S(=O)(=O)Nc2cccnc2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C19H23N3O3S2/c23-19(21-15-5-2-1-3-6-15)14-26-17-8-10-18(11-9-17)27(24,25)22-16-7-4-12-20-13-16/h4,7-13,15,22H,1-3,5-6,14H2,(H,21,23) |
| InChIKey | OIAZPASBPLCXHW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |