C16H21N2O3S- — CID 2403044
2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 2403044) has the molecular formula C16H21N2O3S- and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2403044 |
| Molecular Formula | C16H21N2O3S- |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | O=C(CSc1ncccc1C(=O)[O-])NC1CCCCCCC1 |
| InChI | InChI=1S/C16H22N2O3S/c19-14(18-12-7-4-2-1-3-5-8-12)11-22-15-13(16(20)21)9-6-10-17-15/h6,9-10,12H,1-5,7-8,11H2,(H,18,19)(H,20,21)/p-1 |
| InChIKey | CQPPPECEHQPLBJ-UHFFFAOYSA-M |
| XLogP | 1.77 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |