C15H19N5OS — CID 95919214
N-cyclohexyl-2-(3-pyrazol-1-ylpyrazin-2-yl)sulfanylacetamide (PubChem CID 95919214) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-pyrazol-1-ylpyrazin-2-yl)sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-(3-pyrazol-1-ylpyrazin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 95919214 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-cyclohexyl-2-(3-pyrazol-1-ylpyrazin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nccnc1-n1cccn1)NC1CCCCC1 |
| InChI | InChI=1S/C15H19N5OS/c21-13(19-12-5-2-1-3-6-12)11-22-15-14(16-8-9-17-15)20-10-4-7-18-20/h4,7-10,12H,1-3,5-6,11H2,(H,19,21) |
| InChIKey | FUTYZJCCKFSBGG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |