C11H16N4O2S — CID 23605473
N-cyclohexyl-2-[(3-oxo-2H-1,2,4-triazin-5-yl)sulfanyl]acetamide (PubChem CID 23605473) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is N-cyclohexyl-2-[(3-oxo-2H-1,2,4-triazin-5-yl)sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[(3-oxo-2H-1,2,4-triazin-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 23605473 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-cyclohexyl-2-[(3-oxo-2H-1,2,4-triazin-5-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1cn[nH]c(=O)n1)NC1CCCCC1 |
| InChI | InChI=1S/C11H16N4O2S/c16-9(13-8-4-2-1-3-5-8)7-18-10-6-12-15-11(17)14-10/h6,8H,1-5,7H2,(H,13,16)(H,14,15,17) |
| InChIKey | IYZIALUYUZGKAZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |