C16H19N3S — CID 64626428
N-propyl-2-pyrazin-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 64626428) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is N-propyl-2-pyrazin-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-propyl-2-pyrazin-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 64626428 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-propyl-2-pyrazin-2-ylsulfanyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CCCNC1c2ccccc2CC1Sc1cnccn1 |
| InChI | InChI=1S/C16H19N3S/c1-2-7-19-16-13-6-4-3-5-12(13)10-14(16)20-15-11-17-8-9-18-15/h3-6,8-9,11,14,16,19H,2,7,10H2,1H3 |
| InChIKey | JKZGCBQQDOJVHY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |