C17H22N2S2 — CID 64627513
N-ethyl-4-phenyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine (PubChem CID 64627513) has the molecular formula C17H22N2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is N-ethyl-4-phenyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine.
| Compound Name | N-ethyl-4-phenyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64627513 |
| Molecular Formula | C17H22N2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-ethyl-4-phenyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
| SMILES | CCNC1CCC(c2ccccc2)CC1Sc1nccs1 |
| InChI | InChI=1S/C17H22N2S2/c1-2-18-15-9-8-14(13-6-4-3-5-7-13)12-16(15)21-17-19-10-11-20-17/h3-7,10-11,14-16,18H,2,8-9,12H2,1H3 |
| InChIKey | AAZKXVJOPSEXNS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|