C14H24N2S2 — CID 64627899
4,4-dimethyl-N-propyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine (PubChem CID 64627899) has the molecular formula C14H24N2S2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 4,4-dimethyl-N-propyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine.
| Compound Name | 4,4-dimethyl-N-propyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64627899 |
| Molecular Formula | C14H24N2S2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4,4-dimethyl-N-propyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
| SMILES | CCCNC1CCC(C)(C)CC1Sc1nccs1 |
| InChI | InChI=1S/C14H24N2S2/c1-4-7-15-11-5-6-14(2,3)10-12(11)18-13-16-8-9-17-13/h8-9,11-12,15H,4-7,10H2,1-3H3 |
| InChIKey | KJJVBHIGDZPZDX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|