About N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine
N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine (PubChem CID 64648022) has the molecular formula C10H17N3S2
and a molecular weight of 243.40 g/mol. Its IUPAC name is N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine |
| PubChem CID | 64648022 |
| Molecular Formula | C10H17N3S2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine |
| SMILES | CCCNC1CCCC1Sc1nncs1 |
| InChI | InChI=1S/C10H17N3S2/c1-2-6-11-8-4-3-5-9(8)15-10-13-12-7-14-10/h7-9,11H,2-6H2,1H3 |
| InChIKey | CDNXVPHKWCNLPD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine?
The IUPAC name of N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine (CID 64648022) is N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine.
What is the SMILES notation for N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine?
The canonical SMILES for N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine is CCCNC1CCCC1Sc1nncs1.
What is the InChIKey of N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine?
The InChIKey is CDNXVPHKWCNLPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S2/c1-2-6-11-8-4-3-5-9(8)15-10-13-12-7-14-10/h7-9,11H,2-6H2,1H3.
What are the key properties of N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine?
N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine has a molecular weight of 243.40 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-2-(1,3,4-thiadiazol-2-ylsulfanyl)cyclopentan-1-amine is sourced from PubChem (CID 64648022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).