C13H22N2S2 — CID 64735197
N-ethyl-3,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine (PubChem CID 64735197) has the molecular formula C13H22N2S2 and a molecular weight of 270.47 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine.
| Compound Name | N-ethyl-3,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64735197 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-ethyl-3,5-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)cyclohexan-1-amine |
| SMILES | CCNC1CC(C)CC(C)C1Sc1nccs1 |
| InChI | InChI=1S/C13H22N2S2/c1-4-14-11-8-9(2)7-10(3)12(11)17-13-15-5-6-16-13/h5-6,9-12,14H,4,7-8H2,1-3H3 |
| InChIKey | MTOROYFAYAYBSL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|