C14H16Cl2O3S — CID 64637120
2-cyclohexylsulfonyl-1-(2,4-dichlorophenyl)ethanone (PubChem CID 64637120) has the molecular formula C14H16Cl2O3S and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-cyclohexylsulfonyl-1-(2,4-dichlorophenyl)ethanone.
| Compound Name | 2-cyclohexylsulfonyl-1-(2,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 64637120 |
| Molecular Formula | C14H16Cl2O3S |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-cyclohexylsulfonyl-1-(2,4-dichlorophenyl)ethanone |
| SMILES | O=C(CS(=O)(=O)C1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H16Cl2O3S/c15-10-6-7-12(13(16)8-10)14(17)9-20(18,19)11-4-2-1-3-5-11/h6-8,11H,1-5,9H2 |
| InChIKey | PPHIDGJFCVFTIE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |