C15H15Cl2N3O3S — CID 6464225
2-(2,5-dichloro-N-methylsulfonylanilino)-N-pyridin-3-ylpropanamide (PubChem CID 6464225) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-pyridin-3-ylpropanamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 6464225 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-pyridin-3-ylpropanamide |
| SMILES | CC(C(=O)Nc1cccnc1)N(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-10(15(21)19-12-4-3-7-18-9-12)20(24(2,22)23)14-8-11(16)5-6-13(14)17/h3-10H,1-2H3,(H,19,21) |
| InChIKey | IJORNUJBAIBYMC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |